A3426512
3,4-Difluorophenyl Isothiocyanate , 98% , 113028-75-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB510.40 | In Stock |
|
| 5G | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 170°C(lit.) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| refractive index | 1.5970 to 1.6010 |
| form | liquid |
| color | Yellow |
| InChI | InChI=1S/C7H3F2NS/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H |
| InChIKey | SVZKYXSJICYUOH-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(N=C=S)C=C1F |
| CAS DataBase Reference | 113028-75-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332-H315-H319-H335 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P304+P340+P312-P403+P233-P405 |
| RIDADR | UN 2810 6.1/PG III |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2930909899 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
