A3433912
2-Dimethylaminopyridine , >98.0%(GC) , 5683-33-0
CAS NO.:5683-33-0
Empirical Formula: C7H10N2
Molecular Weight: 122.17
MDL number: MFCD00006261
EINECS: 227-147-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB519.20 | In Stock |
|
| 100G | RMB1919.20 | In Stock |
|
| 500g | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182°C |
| Boiling point: | 191 °C(lit.) |
| Density | 0.984 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 167 °F |
| storage temp. | Store below +30°C. |
| pka | 7.04±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Water Solubility | Soluble in water. |
| BRN | 110353 |
| InChI | InChI=1S/C7H10N2/c1-9(2)7-5-3-4-6-8-7/h3-6H,1-2H3 |
| InChIKey | PSHKMPUSSFXUIA-UHFFFAOYSA-N |
| SMILES | C1(N(C)C)=NC=CC=C1 |
| CAS DataBase Reference | 5683-33-0(CAS DataBase Reference) |
| NIST Chemistry Reference | N,N-Dimethyl-2-pyridinamine(5683-33-0) |
Description and Uses
2-(Dimethylamino)pyridine in toluene at room temperature in the presence of 1.1 equivalent of methyl trifluoromethanesulfonate forms (2-pyridyl)-trimethylammonium trifluoromethanesulfonate salt. It is used as a model substrate in the preparation of chelate carbene via cyclometalation, H2 loss and reversible α-elimination.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-34-23/24/25 |
| Safety Statements | 23-26-36-45-36/37/39-27 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| RTECS | US9200000 |
| F | 10 |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29333999 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |






