A3437257
1-Hydroxyindan , 96% , 6351-10-6
Synonym(s):
(±)-1-Hydroxyindan;(±)-1-Indanol
CAS NO.:6351-10-6
Empirical Formula: C9H10O
Molecular Weight: 134.18
MDL number: MFCD00003797
EINECS: 228-755-3
| Pack Size | Price | Stock | Quantity |
| 25g | RMB95.20 | In Stock |
|
| 100g | RMB303.20 | In Stock |
|
| 500g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-53 °C |
| Boiling point: | 128 °C12 mm Hg(lit.) |
| Density | 0.8540 (rough estimate) |
| refractive index | 1.5630 (estimate) |
| Flash point: | 145 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| pka | 14.23±0.20(Predicted) |
| form | Crystalline Solid |
| color | White to slightly yellow |
| Water Solubility | Soluble in water 10 g/L at 20°C, ethanol, benzene. |
| BRN | 2042960 |
| InChI | InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2 |
| InChIKey | YIAPLDFPUUJILH-UHFFFAOYSA-N |
| SMILES | C1(O)C2=C(C=CC=C2)CC1 |
| CAS DataBase Reference | 6351-10-6(CAS DataBase Reference) |
Description and Uses
1-Indanol derivative was found to be an efficient ligand for the palladium-catalyzed asymmetric Heck reaction. It is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NK7300000 |
| Hazard Note | Irritant |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






