A3440712
Diethyl Diethylmalonate , >97.0%(GC) , 77-25-8
Synonym(s):
Diethyl 3,3-pentanedicarboxylate
CAS NO.:77-25-8
Empirical Formula: C11H20O4
Molecular Weight: 216.27
MDL number: MFCD00009132
EINECS: 201-016-2
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB111.20 | In Stock |
|
| 100ML | RMB303.20 | In Stock |
|
| 500ML | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 228-230 °C (lit.) |
| Density | 0.99 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 202 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Sparingly) |
| form | Oil |
| color | Clear Colourless |
| Specific Gravity | 0.988 (20/4℃) |
| Merck | 14,3823 |
| InChI | 1S/C11H20O4/c1-5-11(6-2,9(12)14-7-3)10(13)15-8-4/h5-8H2,1-4H3 |
| InChIKey | ZKBBUZRGPULIRN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)(CC)C(=O)OCC |
| LogP | 2.463 (est) |
| CAS DataBase Reference | 77-25-8(CAS DataBase Reference) |
| EPA Substance Registry System | Propanedioic acid, diethyl-, diethyl ester (77-25-8) |
Description and Uses
Diethyl Diethylmalonate is an intermediate in the synthesis of Barbital (B118500), a prototype of the barbiturate hypnotics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29171900 |
| Storage Class | 10 - Combustible liquids |





![Bis(1,2,2,6,6-pentamethyl-4-piperidyl)[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]butylmalonate](https://img.chemicalbook.com/CAS/GIF/63843-89-0.gif)
