A3442912
1,4-Diacetylbenzene , >98.0% , 1009-61-6
CAS NO.:1009-61-6
Empirical Formula: C10H10O2
Molecular Weight: 162.19
MDL number: MFCD00008750
EINECS: 213-769-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB230.40 | In Stock |
|
| 25g | RMB1316.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-113 °C (lit.) |
| Boiling point: | 120 °C / 1mmHg |
| Density | 1.0613 (rough estimate) |
| refractive index | 1.5120 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystaline |
| color | White to Almost white |
| Water Solubility | 6.309mg/L(25 ºC) |
| BRN | 1907515 |
| InChI | InChI=1S/C10H10O2/c1-7(11)9-3-5-10(6-4-9)8(2)12/h3-6H,1-2H3 |
| InChIKey | SKBBQSLSGRSQAJ-UHFFFAOYSA-N |
| SMILES | C1(C(=O)C)=CC=C(C(=O)C)C=C1 |
| CAS DataBase Reference | 1009-61-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1,1'-(1,4-phenylene)bis-(1009-61-6) |
| EPA Substance Registry System | Ethanone, 1,1'-(1,4-phenylene)bis- (1009-61-6) |
Description and Uses
1,1''-(1,4-phenylene)bis-Ethanone can undergo oxidative C-C Bond Cleavage to synthesize an aryl carboxylic acid with an iodine catalyst . 1,1''-(1,4-phenylene)bis-Ethanone is also capable of Suzuki-Miyaura coupling.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H304-H350 |
| Precautionary statements | P201-P202-P281-P301+P310-P308+P313-P331-P403-P501c |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29143990 |



![METHANONE, 1,1'-(1,4-PHENYLENE)BIS[1-(4-FLUOROPHENYL)-]](https://img.chemicalbook.com/CAS/GIF/68418-51-9.gif)


