A3444712
2',4'-Dichloropropiophenone , >97.0%(GC) , 37885-41-9
CAS NO.：37885-41-9
Empirical Formula: C9H8Cl2O
Molecular Weight: 203.07
MDL number: MFCD00027396
EINECS: 253-700-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25g | RMB2399.20 | In Stock |
|
| 100g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 121-123°C 7mm |
| Density | 1,287 g/cm3 |
| refractive index | 1.551-1.553 |
| Flash point: | >110°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump |
| color | White to Light yellow |
| Water Solubility | Slightly soluble in water |
| BRN | 2248270 |
| InChI | InChI=1S/C9H8Cl2O/c1-2-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2H2,1H3 |
| InChIKey | FBMTWRZQBRHOPF-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1Cl)(=O)CC |
| CAS DataBase Reference | 37885-41-9(CAS DataBase Reference) |
Description and Uses
2',4'-Dichloropropiophenone is used in the synthesis of (S)-3-chloro-1-(4-chlorophenyl)-1-propanol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| HS Code | 2914.79.9000 |
