A3445312
3,4-Diethoxybenzaldehyde , >98.0%(GC) , 2029-94-9
CAS NO.:2029-94-9
Empirical Formula: C11H14O3
Molecular Weight: 194.23
MDL number: MFCD00016607
EINECS: 217-979-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB48.80 | In Stock |
|
| 5G | RMB184.00 | In Stock |
|
| 25G | RMB703.20 | In Stock |
|
| 100g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 22°C |
| Boiling point: | 293-294 °C (lit.) |
| Density | 1.097 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 225 °F |
| storage temp. | 2-8°C, stored under nitrogen |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C11H14O3/c1-3-13-10-6-5-9(8-12)7-11(10)14-4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | SSTRYEXQYQGGAS-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(OCC)c(OCC)c1 |
| LogP | 2.385 (est) |
| CAS DataBase Reference | 2029-94-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 3,4-diethoxy- (2029-94-9) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Safety Statements | 23-24/25 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29124990 |
| Storage Class | 10 - Combustible liquids |






