A3449512
Disodium Adipate , >98.0%(T) , 7486-38-6
CAS NO.:7486-38-6
Empirical Formula: C6H8Na2O4
Molecular Weight: 190.1
MDL number: MFCD00070498
EINECS: 231-293-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB68.00 | In Stock |
|
| 25G | RMB224.00 | In Stock |
|
| 100g | RMB577.60 | In Stock |
|
| 500G | RMB2152.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 300℃[at 101 325 Pa] |
| pka | 4.43[at 20 ℃] |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | almost transparency |
| InChI | InChI=1S/C6H10O4.2Na/c7-5(8)3-1-2-4-6(9)10;;/h1-4H2,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| InChIKey | KYKFCSHPTAVNJD-UHFFFAOYSA-L |
| SMILES | C([O-])(=O)CCCCC([O-])=O.[Na+].[Na+] |
| LogP | -5.03 |
| EPA Substance Registry System | Hexanedioic acid, disodium salt (7486-38-6) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| RTECS | AV1770000 |
| TSCA | TSCA listed |
| HS Code | 2917.12.1000 |
| REACH Registrations | Active |





