A3455656
3-Ethoxyperfluoro(2-methylhexane) , 297730-93-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB531.20 | In Stock |
|
| 100g | RMB1592.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -100°C |
| Boiling point: | 130°C |
| Density | 1,61 g/cm3 |
| vapor pressure | 8.466hPa at 20℃ |
| storage temp. | Refrigerator, Under inert atmosphere |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Specific Gravity | 1.61 |
| Stability: | Volatile |
| InChI | InChI=1S/C9H5F15O/c1-2-25-6(15,3(10,7(16,17)18)8(19,20)21)4(11,12)5(13,14)9(22,23)24/h2H2,1H3 |
| InChIKey | HHBBIOLEJRWIGU-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(F)(C(F)(F)F)C(OCC)(F)C(F)(F)C(F)(F)C(F)(F)F |
| LogP | 6 at 23℃ |
| EPA Substance Registry System | Hexane, 3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)- (297730-93-9) |
Description and Uses
2-(Trifluoromethyl)-3-ethoxydodecafluorohexane can be used for temperature sensitive protein expression in protocells. It can also be used for light dispersion with enhanced thermal conductivity containing inorganic particles
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 23-24/25 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 2909199050 |







