LN-651757
ETHYL PERFLUOROBUTYL ETHER , 99.5%min , 163702-06-5
| Pack Size | Price | Stock | Quantity |
| 50KG | Inquiry | In Stock |
|
| 1KG | USD43.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -138 oC |
| Boiling point: | 49.5±40.0 °C(Predicted) |
| Density | 1.441±0.06 g/cm3(Predicted) |
| vapor pressure | 14,532.1 Pa [@ 25 oC ] |
| form | Liquid |
| color | Colorless |
| Odor | Faint Odor |
| InChI | InChI=1S/C6H5F9O/c1-2-16-6(14,15)3(7,4(8,9)10)5(11,12)13/h2H2,1H3 |
| InChIKey | SQEGLLMNIBLLNQ-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(C(OCC)(F)F)(F)C(F)(F)F |
| EPA Substance Registry System | Propane, 2-(ethoxydifluoromethyl)-1,1,1,2,3,3,3-heptafluoro- (163702-06-5) |
Description and Uses
Ethyl perfluorobutyl ether (163702-06-5) is a fluorinated organic solvent that has several industrial uses.It is also used as a functional fluid in closed systems such as heat transfer systems and hydraulic systems.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H413 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P |
