S7749148
Ethoxynonafluorobutane , 99.0%,mixtureoftwoisomers
CAS NO.:
Empirical Formula: C6H5F9O
Molecular Weight: 264.09
MDL number: MFCD01862062
EINECS: 425-340-0
| Pack Size | Price | Stock | Quantity |
| 100mL | RMB509.57 | In Stock |
|
| 1L | RMB2933.38 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -138 °C (lit.) |
| Boiling point: | 76 °C (lit.) |
| Density | 1.428 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 39 °F |
| λmax | λ: 220 nm Amax: 1.0 λ: 225 nm Amax: 0.35 λ: 250 nm Amax: 0.05 λ: 300-400 nm Amax: 0.01 |
| Cosmetics Ingredients Functions | SOLVENT |
| InChI | InChI=1S/C6H5F9O/c1-2-16-6(14,15)4(9,10)3(7,8)5(11,12)13/h2H2,1H3 |
| InChIKey | DFUYAWQUODQGFF-UHFFFAOYSA-N |
| SMILES | C(OCC)(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 163702-05-4(CAS DataBase Reference) |
| EPA Substance Registry System | Ethyl nonafluorobutyl ether (163702-05-4) |
Description and Uses
Ethoxynonafluorobutane can be called as an eco-friendly solvent, which finds applications in chromatography since it has high lipophilic character as a result of which, it can be used as a substitute for hexane.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P273-P501 |
| Hazard Codes | F,Xn,Xi |
| Risk Statements | 11-42-36/37/38 |
| Safety Statements | 16-23-45-26 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Autoignition Temperature | 707 °F |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 4 |






