A3459612
Decamethyltetrasiloxane , >97.0%(GC) , 141-62-8
CAS NO.:141-62-8
Empirical Formula: C10H30O3Si4
Molecular Weight: 310.69
MDL number: MFCD00008263
EINECS: 205-491-7
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB61.60 | In Stock |
|
| 25ML | RMB157.60 | In Stock |
|
| 100ML | RMB515.20 | In Stock |
|
| 500ml | RMB2559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ?68 °C (lit.) |
| Boiling point: | 194 °C (lit.) |
| Density | 0.854 g/mL at 25 °C (lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | 73Pa at 25℃ |
| refractive index | n |
| Flash point: | 144 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | <0.1mg/l |
| form | liquid |
| Specific Gravity | 0.854 |
| color | Colourless to Pale Yellow |
| Water Solubility | 6.74μg/L at 23℃ |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| Merck | 14,2850 |
| BRN | 1776881 |
| Dielectric constant | 2.4(20℃) |
| Stability: | Moisture Sensitive |
| Cosmetics Ingredients Functions | ANTIFOAMING |
| InChI | 1S/C10H30O3Si4/c1-14(2,3)11-16(7,8)13-17(9,10)12-15(4,5)6/h1-10H3 |
| InChIKey | YFCGDEUVHLPRCZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| LogP | 8.21 at 25.1℃ |
| CAS DataBase Reference | 141-62-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrasiloxane, decamethyl-(141-62-8) |
| EPA Substance Registry System | Tetrasiloxane, decamethyl- (141-62-8) |
Description and Uses
A non-cyclic silicone oligomer. Used in the methylation of mercury(II) salts. Study shows that it transformed by a specific microflora and in the natural environment degraded by mechanisms similar to other organic compounds.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-37/39-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |






