A3462112
3,3-Dimethylglutaric Anhydride , >97.0%(T) , 4160-82-1
CAS NO.:4160-82-1
Empirical Formula: C7H10O3
Molecular Weight: 142.15
MDL number: MFCD00006684
EINECS: 223-998-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB144.80 | In Stock |
|
| 25G | RMB565.60 | In Stock |
|
| 100g | RMB1952.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-126 °C (lit.) |
| Boiling point: | 181 °C/25 mmHg (lit.) |
| Density | 1.1643 (rough estimate) |
| refractive index | 1.4730 (estimate) |
| Flash point: | 181°C/25mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | White to off-white |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C7H10O3/c1-7(2)3-5(8)10-6(9)4-7/h3-4H2,1-2H3 |
| InChIKey | HIJQFTSZBHDYKW-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)CC(C)(C)C1 |
| CAS DataBase Reference | 4160-82-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Pyran-2,6(3H)-dione, dihydro-4,4-dimethyl- (4160-82-1) |
Description and Uses
3,3-Dimethylglutaric Anhydride acts as a reagent for the synthesis of piscidinol A derivatives and their ability to inhibit HIV-1 protease.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29171990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![8-Oxaspiro[4.5]decane-7,9-dione](https://img.chemicalbook.com/CAS/GIF/5662-95-3.gif)
