A3470712
2,4-Dichloro-5-fluorobenzoyl Chloride , ≥98.0%(GC) , 86393-34-2
CAS NO.：86393-34-2
Empirical Formula: C7H2Cl3FO
Molecular Weight: 227.45
MDL number: MFCD00075341
EINECS: 428-390-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB88.00 | In Stock |
|
| 100g | RMB280.00 | In Stock |
|
| 500g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 143-144 °C35 mm Hg(lit.) |
| Density | 1.568 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | RT, stored under nitrogen |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.568 |
| Sensitive | Moisture Sensitive |
| BRN | 4989077 |
| InChI | InChI=1S/C7H2Cl3FO/c8-4-2-5(9)6(11)1-3(4)7(10)12/h1-2H |
| InChIKey | RPZXUSJCSDQNTE-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC(F)=C(Cl)C=C1Cl |
| CAS DataBase Reference | 86393-34-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H318-H335-H402-H290-H314-H317-H412 |
| Precautionary statements | P234-P260-P264-P272-P273-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P262-P303+P361+P353-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 1 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2916399090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
