A3472412
2,3-Dicyanohydroquinone , >97.0% , 4733-50-0
Synonym(s):
2,3-Dicyano-1,4-hydroquinone;2,3-Dicyanohydroquinone;3,6-Dihydroxyphthalonitrile;DCH
CAS NO.：4733-50-0
Empirical Formula: C8H4N2O2
Molecular Weight: 160.13
MDL number: MFCD00001790
EINECS: 225-241-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >230 °C (dec.) (lit.) |
| Boiling point: | 286.01°C (rough estimate) |
| Density | 1.3848 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Store below +30°C. |
| form | Crystalline Powder or Needles |
| pka | 6.21±0.23(Predicted) |
| color | Khaki to brown |
| Water Solubility | Soluble in hot water |
| BRN | 2101249 |
| InChI | InChI=1S/C8H4N2O2/c9-3-5-6(4-10)8(12)2-1-7(5)11/h1-2,11-12H |
| InChIKey | MPAIWVOBMLSHQA-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(O)C=CC(O)=C1C#N |
| CAS DataBase Reference | 4733-50-0(CAS DataBase Reference) |
Description and Uses
2,3-Dicyanohydroquinone was used in the synthesis of phthalonitrile-3,6-ditriflate. It is a fluorescent dye and was used in determination of intracellular pH and calcium in avian neural crest cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39 |
| RIDADR | UN 2811 6.1/PG III |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
