A7933412
Tetrafluoroisophthalonitrile , >98.0%(GC) , 2377-81-3
CAS NO.：2377-81-3
Empirical Formula: C8F4N2
Molecular Weight: 200.09
MDL number: MFCD00013290
EINECS: 623-653-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB87.20 | In Stock |
|
| 5G | RMB335.20 | In Stock |
|
| 10g | RMB591.20 | In Stock |
|
| 25G | RMB1335.20 | In Stock |
|
| 100g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-79 °C(lit.) |
| Boiling point: | 113-115 °C(Press: 10 Torr) |
| Density | 1.6184 (estimate) |
| Flash point: | 79 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 6925899 |
| Stability: | Stability |
| InChI | InChI=1S/C8F4N2/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14 |
| InChIKey | WVHMPQKZPHOCRD-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(F)C(F)=C(F)C(C#N)=C1F |
| CAS DataBase Reference | 2377-81-3(CAS DataBase Reference) |
Description and Uses
2,4,5,6-Tetrafluoroisophthalonitrile and derivatives have been used to study their antimicrobial activity against Staphylococcus aureus, Bacillus cereus (Gram-pos. bacteria), Escherichia coli, Pseudomonas aeruginosa (Gram-neg. bacteria); and Candida albicans (Fungi).
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H331-H335-H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37/39 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
