A4330812
2-Fluoro-5-methylbenzonitrile , 99% , 64113-84-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB50.40 | In Stock |
|
| 5G | RMB145.60 | In Stock |
|
| 25g | RMB499.20 | In Stock |
|
| 100g | RMB1750.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-52 °C (lit.) |
| Boiling point: | 204 |
| Density | 1.11±0.1 g/cm3(Predicted) |
| Flash point: | 201 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C8H6FN/c1-6-2-3-8(9)7(4-6)5-10/h2-4H,1H3 |
| InChIKey | CMAOLVNGLTWICC-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(C)=CC=C1F |
| CAS DataBase Reference | 64113-84-4(CAS DataBase Reference) |
Description and Uses
2-Fluoro-5-methylbenzonitrile is used in the synthesis of indazoles which have the potential to be selective for the α2-adrenoceptor and central and peripheral nervous systems.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,T |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
