A3476712
4,4'-Dibromobenzil , >97.0% , 35578-47-3
CAS NO.：35578-47-3
Empirical Formula: C14H8Br2O2
Molecular Weight: 368.02
MDL number: MFCD00000104
EINECS: 252-628-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.80 | In Stock |
|
| 5G | RMB145.60 | In Stock |
|
| 10g | RMB311.20 | In Stock |
|
| 25G | RMB553.60 | In Stock |
|
| 50g | RMB1199.20 | In Stock |
|
| 100G | RMB1799.20 | In Stock |
|
| 250g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 224-226 °C(lit.) |
| Boiling point: | 457.2±30.0 °C(Predicted) |
| Density | 1.6983 (rough estimate) |
| refractive index | 1.4947 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | Yellow |
| Water Solubility | Sparingly soluble in water. |
| InChI | InChI=1S/C14H8Br2O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8H |
| InChIKey | NYCBYBDDECLFPE-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Br)C=C1)(=O)C(C1=CC=C(Br)C=C1)=O |
| CAS DataBase Reference | 35578-47-3(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanedione, bis(4-bromophenyl)- (35578-47-3) |
Description and Uses
4,4′-Dibromobenzil was used in preparation of 5,5′-bis -(4-bromo-phenyl)-3-methyl-imidazolidine-2,4-dione, 5,5′- bis -(4-bromo-phenyl)-3-butyl-imidazolidine-2,4-dione, 5,5′-bis-(4-bromo-phenyl)-3-pentyl-imidazolidine-2,4-dione and 5,5′-bis -(4-chloro-phenyl)-3-ethyl imidazolidine-2,4-dione. It was also used in synthesis of novel quinoxaline-based sensitizers for dye-sensitized solar cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29147000 |
