A3489212
1,6-Dihydroxynaphthalene , >99.0%(GC) , 575-44-0
Synonym(s):
1,6-Naphthalenediol
CAS NO.:575-44-0
Empirical Formula: C10H8O2
Molecular Weight: 160.17
MDL number: MFCD00003981
EINECS: 209-386-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB32.00 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100g | RMB196.00 | In Stock |
|
| 500G | RMB758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-133 °C (lit.) |
| Boiling point: | 246.06°C (rough estimate) |
| Density | 1.0924 (rough estimate) |
| refractive index | 1.5418 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | very faint turbidity in Methanol |
| pka | 9.26±0.40(Predicted) |
| form | Powder or Crystalline Powder |
| color | White to brown |
| BRN | 1939032 |
| InChI | InChI=1S/C10H8O2/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-6,11-12H |
| InChIKey | FZZQNEVOYIYFPF-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C=C(O)C=C2)=CC=C1 |
| CAS DataBase Reference | 575-44-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,6-Naphthalenediol(575-44-0) |
| EPA Substance Registry System | 1,6-Naphthalenediol (575-44-0) |
Description and Uses
1,6-Dihydroxynaphthalene is used as a dye and pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | QJ4743333 |
| TSCA | TSCA listed |
| HS Code | 29072990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





