A3494612
1,5-Dimethylpyrazole , >98.0%(T) , 694-31-5
CAS NO.：694-31-5
Empirical Formula: C5H8N2
Molecular Weight: 96.13
MDL number: MFCD01646129
EINECS: 614-969-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB55.20 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25g | RMB441.60 | In Stock |
|
| 100g | RMB1406.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82.75°C (estimate) |
| Boiling point: | 158°C(lit.) |
| Density | 0.9813 |
| refractive index | 1.4790 to 1.4830 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.83±0.10(Predicted) |
| form | liquid |
| color | Clear |
| λmax | 217nm(EtOH)(lit.) |
| InChI | InChI=1S/C5H8N2/c1-5-3-4-6-7(5)2/h3-4H,1-2H3 |
| InChIKey | LSZQMSSIUQNTDX-UHFFFAOYSA-N |
| SMILES | N1(C)C(C)=CC=N1 |
| CAS DataBase Reference | 694-31-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,5-Dimethylpyrazole(694-31-5) |
Description and Uses
1,5-Dimethylpyrazole is widely used in food, health products, cosmetics and other fields.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 1993 3/PG III |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2933199090 |
