M5099656
Pyraclostrobin , 97% , 175013-18-0
Synonym(s):
Methyl {2-[1-(4-chlorophenyl)-1H-pyrazol-3-yloxymethyl]phenyl}methoxycarbamate
CAS NO.:175013-18-0
Empirical Formula: C19H18ClN3O4
Molecular Weight: 387.82
MDL number: MFCD03792774
EINECS: 605-747-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB518.40 | In Stock |
|
| 1g | RMB1476.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63.7-65.2° |
| Boiling point: | 501.1±60.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | DMSO: 250 mg/mL (644.63 mM) |
| pka | -0.23±0.10(Predicted) |
| form | Solid |
| color | Off-white to light yellow |
| Stability: | Toxic |
| InChI | InChI=1S/C19H18ClN3O4/c1-25-19(24)23(26-2)17-6-4-3-5-14(17)13-27-18-11-12-22(21-18)16-9-7-15(20)8-10-16/h3-12H,13H2,1-2H3 |
| InChIKey | HZRSNVGNWUDEFX-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)N(C1=CC=CC=C1COC1C=CN(C2=CC=C(Cl)C=C2)N=1)OC |
| LogP | 4.250 (est) |
| NIST Chemistry Reference | Pyraclostrobine(175013-18-0) |
| EPA Substance Registry System | Pyraclostrobin (175013-18-0) |
Description and Uses
Agricultural fungicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H331-H410 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P304+P340+P311 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | EZ3441000 |
| Hazardous Substances Data | 175013-18-0(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >5000 orally; >2000 dermally; LC50 in rainbow trout: 0.006 mg/l (Ammermann) |







