A5304812
L-Born-2-yl acetate , Analysis standard , 5655-61-8
Synonym(s):
endo-(1S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl acetate
CAS NO.:5655-61-8
Empirical Formula: C12H20O2
Molecular Weight: 196.29
MDL number: MFCD00135942
EINECS: 227-101-4
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB728.00 | In Stock |
|
| 5ML | RMB2212.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27°C |
| Boiling point: | 223-224 °C(lit.) |
| Density | 0.984g/mL20°C |
| vapor pressure | 0.6 mm Hg ( 20 °C) |
| FEMA | 4080 | L-BORNYL ACETATE |
| refractive index | n |
| Flash point: | 184 °F |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless |
| Odor | at 100.00 %. sweet balsamic woody fresh pine needle herbal |
| Odor Type | balsamic |
| optical activity | [α]20/D 46±2°, c = 1% in ethanol |
| Water Solubility | 62.6mg/L at 20℃ |
| Merck | 14,1339 |
| JECFA Number | 1864 |
| BRN | 2502036 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | 1S/C12H20O2/c1-8(13)14-10-7-9-5-6-12(10,4)11(9,2)3/h9-10H,5-7H2,1-4H3/t9-,10+,12+/m0/s1 |
| InChIKey | KGEKLUUHTZCSIP-HOSYDEDBSA-N |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| LogP | 3.74 at 20℃ |
| CAS DataBase Reference | 5655-61-8(CAS DataBase Reference) |
| EPA Substance Registry System | Bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl-, acetate, (1S,2R,4S)- (5655-61-8) |
Description and Uses
Suggested for use in Fougeres, Chypres, Lavender colognes, Room spray fragrances, Bathoils, Pine fragrances, etc. lts odor is richer than that of the iso-Bomyl acetate. Finds some use in flavor compositions for Fruit and Spice flavorings. The concentration will usuallybe about 70-80 ppm in the finished product.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501-P210e-P280a-P370+P378a-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-24/25-36-26 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29153900 |
| Storage Class | 10 - Combustible liquids |






