A2303312
(1S)-(+)-10-Camphorsulfonic acid , 99% , 3144-16-9
Synonym(s):
CSA;MOT;(+)-Camphor-10-sulfonic acid;(1S)-(+)-Camphor-10-sulfonic acid;for resolution of racemates
CAS NO.:3144-16-9
Empirical Formula: C10H16O4S
Molecular Weight: 232.3
MDL number: MFCD00064157
EINECS: 221-554-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB29.60 | In Stock |
|
| 100G | RMB82.40 | In Stock |
|
| 500G | RMB301.60 | In Stock |
|
| 1kg | RMB535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196-200 °C (dec.)(lit.) |
| Boiling point: | 344.46°C (rough estimate) |
| alpha | 22 º (589nm, c=20, H2O 25 ºC) |
| Density | 1.2981 (rough estimate) |
| refractive index | 21.5 ° (C=5, H2O) |
| storage temp. | Store below +30°C. |
| solubility | Exhibit moderate solubility in HCCl. |
| pka | 1.17±0.50(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| PH | 0.3 (200g/l, H2O) |
| biological source | human |
| optical activity | [α]20/D +21.5±1°, c = 10% in H2O |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| Merck | 14,1734 |
| BRN | 2809675 |
| Stability: | Stable. Protect from moisture. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7H,3-6H2,1-2H3,(H,12,13,14)/t7-,10-/m1/s1 |
| InChIKey | MIOPJNTWMNEORI-GMSGAONNSA-N |
| SMILES | [H][C@@]12CC[C@@](CS(O)(=O)=O)(C(=O)C1)C2(C)C |
| CAS DataBase Reference | 3144-16-9(CAS DataBase Reference) |
| EPA Substance Registry System | Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1S,4R)- (3144-16-9) |
Description and Uses
(1S)-(+)-Camphor-10-sulfonic acid is used as stabilizer. (+)-(1S)-camphor-10-sulfonic acid being a very effective resolving agent. . Chiral polyaniline(PANI) nanofibers were synthesized via facilely potentiostatic electropolymerization method without template in the presence of(1S)-(+)camphor-10-sulfonic acid(D-CSA) or(1R)-(-)camphor-10-sulfonic acid(L-CSA) as the dopant. Synthesis of QUATs derived from (1S)-(+)camphor-10-sulfonic acid.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-25-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | ED1550000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Met. Corr. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





