A2267912
(1S)-(+)-10-Camphorsulfonyl chloride , 97% , 21286-54-4
Synonym(s):
(+)-Camphor-10-sulfonyl chloride;(1S)-Camphor-10-sulfonic acid chloride
CAS NO.:21286-54-4
Empirical Formula: C10H15ClO3S
Molecular Weight: 250.74
MDL number: MFCD00064156
EINECS: 244-314-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB269.60 | In Stock |
|
| 100G | RMB885.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-68 °C |
| alpha | 33 º (c=1, CHCl3 22 ºC) |
| Boiling point: | 349.4±15.0 °C(Predicted) |
| Density | 1.2078 (estimate) |
| refractive index | 32 ° (C=1, CHCl3) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Crystalline Powder |
| color | Off-white to beige |
| optical activity | [α]22/D +33°, c = 1 in chloroform |
| Sensitive | Moisture Sensitive |
| BRN | 3205974 |
| InChI | 1S/C10H15ClO3S/c1-9(2)7-3-4-10(9,8(12)5-7)6-15(11,13)14/h7H,3-6H2,1-2H3/t7-,10-/m1/s1 |
| InChIKey | BGABKEVTHIJBIW-UHFFFAOYSA-N |
| SMILES | [H][C@@]12CC[C@@](CS(Cl)(=O)=O)(C(=O)C1)C2(C)C |
| CAS DataBase Reference | 21286-54-4(CAS DataBase Reference) |
| NIST Chemistry Reference | (+)-Camphor-10-sulfonyl chloride(21286-54-4) |
Description and Uses
As a useful synthetic intermediate, D(+)-10-Camphorsulfonyl chloride can be used for asymmetric hydroxylation
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29147000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





