A7096312
D-(-)-Quinic acid , Analysis of standard products, ≥98% , 77-95-2
Synonym(s):
(-)-Quinic acid;D -(−)-Quinic acid;1,3,4,5-Tetrahydroxycyclohexanecarboxylic acid
CAS NO.:77-95-2
Empirical Formula: C7H12O6
Molecular Weight: 192.17
MDL number: MFCD00003864
EINECS: 201-072-8
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-170 °C |
| Boiling point: | 248.13°C (rough estimate) |
| alpha | -44 º (c=11.2, H2O) |
| Density | 1.64 g/cm3 (20℃) |
| bulk density | 670-750kg/m3 |
| refractive index | -43.5 ° (C=10, H2O) |
| storage temp. | Store below +30°C. |
| solubility | 290g/l (experimental) |
| form | Crystalline Powder |
| pka | 4.27±0.50(Predicted) |
| color | White to very slightly yellow |
| PH | 2.0 (10g/l, H2O, 20℃) |
| optical activity | [α]20/D 43.9°, c = 11.2 in H2O |
| Water Solubility | 400 g/l (20 ºC) |
| Merck | 14,8059 |
| BRN | 2212412 |
| Cosmetics Ingredients Functions | BUFFERING |
| InChI | 1S/C7H12O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3-5,8-10,13H,1-2H2,(H,11,12)/t3-,4-,5-,7+/m1/s1 |
| InChIKey | AAWZDTNXLSGCEK-WYWMIBKRSA-N |
| SMILES | O[C@@H]1C[C@@](O)(C[C@@H](O)[C@H]1O)C(O)=O |
| LogP | -2.023 (est) |
| CAS DataBase Reference | 77-95-2(CAS DataBase Reference) |
| EPA Substance Registry System | Quinic acid (77-95-2) |
Description and Uses
These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | GU8650000 |
| HS Code | 29181980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |







