Eucalyptol , 99% , 470-82-6
Synonym(s):
Eucalyptol;1,8-Cineole;1,8-Epoxy-p-menthane;Cineolum;1,3,3-Trimethyl-2-oxabicyclo(2,2,2)-octane
CAS NO.:470-82-6
Empirical Formula: C10H18O
Molecular Weight: 154.25
MDL number: MFCD00167977
EINECS: 207-431-5
PRODUCT Properties
| Melting point: | 1-2 °C(lit.) |
| Boiling point: | 176-177 °C(lit.) |
| Density | 0.9225 |
| vapor pressure | 1.22hPa at 20℃ |
| refractive index | n |
| FEMA | 2465 | EUCALYPTOL |
| Flash point: | 122 °F |
| storage temp. | 2-8°C |
| solubility | 3.5g/l |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Odor | at 10.00 % in dipropylene glycol. eucalyptus herbal camphor medicinal |
| Odor Type | herbal |
| Water Solubility | Soluble in water(3500 mg/L (at 21°C). Miscible with ether, alcohol, chloroform, glacial acetic acid, oils. Soluble in ethanol, ethyl ether; slightly soluble in carbon tetrachloride. |
| FreezingPoint | min. 1.4 ℃ |
| Merck | 14,3895 |
| JECFA Number | 1234 |
| BRN | 105109 |
| Dielectric constant | 4.8399999999999999 |
| Stability: | Stable. Flammable. Incompatible with acids, bases, strong oxidizing agents. |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | DENATURANT PERFUMING TONIC |
| InChI | 1S/C10H18O/c1-9(2)8-4-6-10(3,11-9)7-5-8/h8H,4-7H2,1-3H3/t8-,10+ |
| InChIKey | WEEGYLXZBRQIMU-WAAGHKOSSA-N |
| SMILES | C[C@]12CC[C@H](CC1)C(C)(C)O2 |
| LogP | 3.4 |
| CAS DataBase Reference | 470-82-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Eucalyptol(470-82-6) |
| EPA Substance Registry System | Eucalyptol (470-82-6) |
Description and Uses
Eucalyptol is a bicyclic monoterpene that has been found in Eucalyptus and other plants, including C. sativa and has diverse biological activities, including anti-inflammatory, decongestant, antinociceptive, and insect repellent properties. Eucalyptol (10 μM) inhibits TNF-α, IL-1β, IL-4, and IL-5 production by primary human lymphocytes stimulated by ionomycin and phorbol 12-myristate 13-acetate (PMA; ). It also decreases LPS-induced mucus production by primary human nasal turbinate slices when used at a concentration of 10 μM. Eucalyptol (400 mg/kg) decreases carrageenan-induced hind paw edema in rats and reduces the time spent licking the hind paw in a formalin-induced nociception test in mice. It inhibits A. aegypti mosquitoes from feeding on anesthetized gerbils when applied topically at a concentration of 10% and from laying eggs in an ovipositional bioassay when used at a concentration of 1% in standing water. Formulations containing eucalyptol have been used in mouthwash and cough suppressants.
eucalyptol is considered an antiseptic. This is a monoterpene compound that provides the fragrance associated with the essential oil of eucalyptus. eucalyptol is also used to fragrance cosmetic preparations.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H317 |
| Precautionary statements | P210-P233-P240-P241-P280-P303+P361+P353 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-37/38-41-36/37/38 |
| Safety Statements | 26-39-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| RTECS | OS9275000 |
| TSCA | TSCA listed |
| HS Code | 2932 99 00 |
| HazardClass | 3 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Sens. 1 |
| Hazardous Substances Data | 470-82-6(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 2480 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





