A3496512
2,2'-Dihydroxybenzophenone , 98% , 835-11-0
CAS NO.：835-11-0
Empirical Formula: C13H10O3
Molecular Weight: 214.22
MDL number: MFCD00002217
EINECS: 212-639-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB147.20 | In Stock |
|
| 5G | RMB528.00 | In Stock |
|
| 25G | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-62.5 °C(lit.) |
| Boiling point: | 333°C (estimate) |
| Density | 1.1956 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | RT, stored under nitrogen |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 7.32±0.30(Predicted) |
| color | Light yellow to Yellow to Green |
| InChI | InChI=1S/C13H10O3/c14-11-7-3-1-5-9(11)13(16)10-6-2-4-8-12(10)15/h1-8,14-15H |
| InChIKey | YIYBRXKMQFDHSM-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1O)(C1=CC=CC=C1O)=O |
| CAS DataBase Reference | 835-11-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2914.50.3000 |
