A0682712
Aloe-emodin , Analysis standard , 481-72-1
Synonym(s):
1,8-Dihydroxy 3-hydroxymethylanthraquinone;1,8-Dihydroxy-3-(hydroxymethyl)anthraquinone;3-Hydroxymethylchrysazine;Aloe-emodin;Rhabarberone
CAS NO.:481-72-1
Empirical Formula: C15H10O5
Molecular Weight: 270.24
MDL number: MFCD00017373
EINECS: 207-571-7
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB52.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-224°C |
| Boiling point: | 373.35°C (rough estimate) |
| Density | 1.3280 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 6.30±0.20(Predicted) |
| color | Orange to Dark Orange |
| biological source | synthetic |
| Merck | 14,306 |
| BRN | 2059062 |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChI | 1S/C15H10O5/c16-6-7-4-9-13(11(18)5-7)15(20)12-8(14(9)19)2-1-3-10(12)17/h1-5,16-18H,6H2 |
| InChIKey | YDQWDHRMZQUTBA-UHFFFAOYSA-N |
| SMILES | OCc1cc(O)c2C(=O)c3c(O)cccc3C(=O)c2c1 |
| LogP | 3.254 (est) |
| CAS DataBase Reference | 481-72-1(CAS DataBase Reference) |
Description and Uses
Aloe-emodin has been used as a standard in high performance liquid chromatography (HPLC) for separation and identification of phenolic compounds in Aloe arborescens Miller var. natalensis Berger (Kidachi aloe).





