A1095150
AloinB , 98% , 28371-16-6
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB666.40 | In Stock |
|
| 10mg | RMB1223.20 | In Stock |
|
| 25mg | RMB2655.20 | In Stock |
|
| 50mg | RMB4775.20 | In Stock |
|
| 100mg | RMB7103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147~148℃ |
| Boiling point: | 752.6±60.0 °C(Predicted) |
| Density | 1.647±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 0.25 mg/ml; PBS (pH 7.2): 0.5 mg/ml |
| form | A crystalline solid |
| pka | 7.12±0.40(Predicted) |
| color | Light yellow to yellow |
| InChIKey | AFHJQYHRLPMKHU-GQMFJIQQNA-N |
| SMILES | O[C@@H]1[C@H]([C@H](O)[C@@H](CO)O[C@@]1([H])[C@]1([H])C2=CC=CC(O)=C2C(=O)C2C(=CC(CO)=CC1=2)O)O |&1:1,2,3,5,9,11,r| |
Description and Uses
Aloin B is an aloe exudate and a phytochemical constituent. It is one isomer of Aloin, the other being Aloin A (A575415)
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| HS Code | 29389090 |





