A0650112
Aloin , Analysis of standard products, ≥97% , 1415-73-2
Synonym(s):
1,8-Dihydroxy-10-(β-D -glucopyranosyl)-3-(hydroxymethyl)-9(10H)-anthracenone;10-β-D -Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone;Aloin A;Barbaloin
CAS NO.:1415-73-2
Empirical Formula: C21H22O9
Molecular Weight: 418.39
MDL number: MFCD00151160
EINECS: 215-808-0
| Pack Size | Price | Stock | Quantity |
| 20mg | RMB225.60 | In Stock |
|
| 25MG | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148°C |
| Boiling point: | 456.17°C (rough estimate) |
| Density | 1.3028 (rough estimate) |
| refractive index | 1.6230 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | pyridine: 50 mg/mL, clear, dark red |
| pka | 7.12±0.40(Predicted) |
| form | Solid |
| color | Yellow needles from EtOH |
| biological source | Curacao aloe |
| BRN | 6077558 |
| Stability: | Stable, but light sensitive. Incompatible with bases, strong oxidizing agents. Combustible. |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | AFHJQYHRLPMKHU-WEZNYRQKSA-N |
| SMILES | [C@@]1([H])([C@H]2[C@H](O)[C@H]([C@H](O)[C@@H](CO)O2)O)C2C=CC=C(O)C=2C(=O)C2=C(O)C=C(CO)C=C12 |&1:0,2,3,5,6,8,r| |
| LogP | 0.944 (est) |
Description and Uses
Aloe exudant, used as a stimulant-laxative
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | LZ6520000 |
| F | 8 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LDLo orl-cat: 500 mg/kg HBAMAK 4,1298,35 |





