A0650212
Aloin , 97% , 1415-73-2
Synonym(s):
1,8-Dihydroxy-10-(β-D -glucopyranosyl)-3-(hydroxymethyl)-9(10H)-anthracenone;10-β-D -Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone;Aloin A;Barbaloin
CAS NO.:1415-73-2
Empirical Formula: C21H22O9
Molecular Weight: 418.39
MDL number: MFCD00151160
EINECS: 215-808-0
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB254.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148°C |
| Boiling point: | 456.17°C (rough estimate) |
| Density | 1.3028 (rough estimate) |
| refractive index | 1.6230 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | pyridine: 50 mg/mL, clear, dark red |
| pka | 7.12±0.40(Predicted) |
| form | Solid |
| color | Yellow needles from EtOH |
| biological source | Curacao aloe |
| BRN | 6077558 |
| Stability: | Stable, but light sensitive. Incompatible with bases, strong oxidizing agents. Combustible. |
| InChIKey | AFHJQYHRLPMKHU-WEZNYRQKSA-N |
| SMILES | [C@@]1([H])([C@H]2[C@H](O)[C@H]([C@H](O)[C@@H](CO)O2)O)C2C=CC=C(O)C=2C(=O)C2=C(O)C=C(CO)C=C12 |&1:0,2,3,5,6,8,r| |
| LogP | 0.944 (est) |
Description and Uses
Aloe exudant, used as a stimulant-laxative





