A3497012
2,3-Dicyanopyrazine , 98% , 13481-25-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB380.00 | In Stock |
|
| 25G | RMB1439.20 | In Stock |
|
| 100G | RMB3511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-133 °C (lit.) |
| Boiling point: | 362.2±42.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -7.49±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C6H2N4/c7-3-5-6(4-8)10-2-1-9-5/h1-2H |
| InChIKey | OTVZGAXESBAAQQ-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CN=C1C#N |
| CAS DataBase Reference | 13481-25-9(CAS DataBase Reference) |
Description and Uses
2,3-Pyrazinedicarbonitrile may be used in the synthesis of pyrazino derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
