A3498712
3',5'-Dichloro-2,2,2-trifluoroacetophenone , >96.0%(GC) , 130336-16-2
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB58.40 | In Stock |
|
| 1G | RMB168.00 | In Stock |
|
| 5G | RMB387.20 | In Stock |
|
| 25g | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 265℃ |
| Density | 1.506 |
| refractive index | 1.4980 to 1.5020 |
| Flash point: | 114℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | InChI=1S/C8H3Cl2F3O/c9-5-1-4(2-6(10)3-5)7(14)8(11,12)13/h1-3H |
| InChIKey | DZDSQRPDUCSOQV-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Cl)=CC(Cl)=C1)C(F)(F)F |
| CAS DataBase Reference | 130336-16-2 |
Description and Uses
3'',5''-Dichloro-2,2,2-trifluoroacetophenone is a reagent used for enantioselective preparation of benzazephinoindoles bearing trifluoromethylated quaternary stereocenters catalyzed by chiral spirocyclic phosphoric acids
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2914790090 |
| REACH Registrations | Active |





