A3501912
2,6-Diaminopimelic Acid , >98.0%(T) , 583-93-7
Synonym(s):
rac.-DAP;DL -α,ε-Diaminopimelic acid;DL -2,6-Diaminoheptanedioic acid;2,6-Diaminoheptanedioic acid
CAS NO.：583-93-7
Empirical Formula: C7H14N2O4
Molecular Weight: 190.2
MDL number: MFCD00002637
EINECS: 209-524-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB319.20 | In Stock |
|
| 5g | RMB1252.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~295 °C (dec.) (lit.) |
| Boiling point: | 325.69°C (rough estimate) |
| Density | 1.2963 (rough estimate) |
| refractive index | 1.4331 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Water (Slightly, Heated) |
| pka | 2.20±0.24(Predicted) |
| form | Powder and/or Chunks |
| color | White to beige |
| Water Solubility | Soluble in water, diluted acids and alkali. |
| BRN | 1787719 |
| InChI | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
| InChIKey | GMKMEZVLHJARHF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(N)CCCC(N)C(O)=O |
| CAS DataBase Reference | 583-93-7(CAS DataBase Reference) |
Description and Uses
2,6-Diaminopimelic acid (2,6-DAP) can be used as a building block in the synthesis of tripeptides , and γ-glutamyldiaminopimelic acid derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
