PRODUCT Properties
| Melting point: | ~295 °C (dec.)(lit.) |
| Boiling point: | 426.7±45.0 °C(Predicted) |
| Density | 1.344±0.06 g/cm3(Predicted) |
| pka | 2.20±0.24(Predicted) |
| form | powder |
| InChI | 1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 |
| InChIKey | GMKMEZVLHJARHF-WHFBIAKZSA-N |
| SMILES | OC([C@@H](N)CCC[C@H](N)C(O)=O)=O |
| CAS DataBase Reference | 2577-62-0(CAS DataBase Reference) |
Description and Uses
DL-2,6-Diaminopimelic acid, a stereoisomer of meso-DAP, may be used as a reference material in assays used to identify markers of bacteria and fungi in the rumen of ruminants.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
