A3509312
2,5-Dibromopyrazine , >98.0%(GC) , 23229-26-7
CAS NO.:23229-26-7
Empirical Formula: C4H2Br2N2
Molecular Weight: 237.88
MDL number: MFCD08061601
EINECS: 805-812-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB154.40 | In Stock |
|
| 25G | RMB589.60 | In Stock |
|
| 100G | RMB1829.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45.0 to 49.0 °C |
| Boiling point: | 234.0±35.0 °C(Predicted) |
| Density | 2.197 |
| Flash point: | 95℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -4.28±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C4H2Br2N2/c5-3-1-7-4(6)2-8-3/h1-2H |
| InChIKey | KIYKHEOWZLJZSB-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(Br)N=C1 |
| CAS DataBase Reference | 23229-26-7 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







