A3529012
2,4-Diaminopyrimidine , >98.0%(HPLC) , 156-81-0
CAS NO.：156-81-0
Empirical Formula: C4H6N4
Molecular Weight: 110.12
MDL number: MFCD00038023
EINECS: 205-862-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB55.20 | In Stock |
|
| 1g | RMB143.20 | In Stock |
|
| 5G | RMB479.20 | In Stock |
|
| 25G | RMB1879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-147 °C (lit.) |
| Boiling point: | 401.7±37.0 °C(Predicted) |
| Density | 1.368±0.06 g/cm3(Predicted) |
| refractive index | 1.46-1.466 |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| form | powder to crystal |
| pka | 7.08±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | 840 g/L (25 ºC) |
| InChI | InChI=1S/C4H6N4/c5-3-1-2-7-4(6)8-3/h1-2H,(H4,5,6,7,8) |
| InChIKey | YAAWASYJIRZXSZ-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC(N)=N1 |
| CAS DataBase Reference | 156-81-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29335990 |
