A3540212
2,2-Difluoroethylamine , >98.0%(GC) , 430-67-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 100g | RMB239.20 | In Stock |
|
| 25g | RMB302.40 | In Stock |
|
| 500g | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 67.5-68.5 |
| Density | 1,15 g/cm3 |
| vapor pressure | 14-56kPa at 20-50℃ |
| refractive index | 1.3410-1.3450 |
| pka | 7.09±0.30(Predicted) |
| form | clear liquid |
| color | Colorless to Yellow |
| InChI | InChI=1S/C2H5F2N/c3-2(4)1-5/h2H,1,5H2 |
| InChIKey | OVRWUZYZECPJOB-UHFFFAOYSA-N |
| SMILES | C(N)C(F)F |
| CAS DataBase Reference | 430-67-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H225-H314 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405-P501 |
| target organs | Respiratory system |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-36/37/39-24/25 |
| RIDADR | 2735 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| PackingGroup | II |
| HS Code | 29211990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Met. Corr. 1 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







