A3546912
2,3-Dimethylhydroquinone , >98.0%(GC) , 608-43-5
Synonym(s):
1,4-Dihydroxy-2,3-dimethylbenzene;2,3-Dimethyl-1,4-benzenediol
| Pack Size | Price | Stock | Quantity |
| 1g | RMB64.00 | In Stock |
|
| 5G | RMB173.60 | In Stock |
|
| 25G | RMB676.80 | In Stock |
|
| 100g | RMB2150.40 | In Stock |
|
| 500g | RMB15199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-225 °C (lit.) |
| Boiling point: | 193.57°C (rough estimate) |
| Density | 1.0340 (rough estimate) |
| refractive index | 1.4698 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 10.85±0.23(Predicted) |
| color | White to off-white |
| Water Solubility | Slightly soluble in water |
| BRN | 636976 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C8H10O2/c1-5-6(2)8(10)4-3-7(5)9/h3-4,9-10H,1-2H3 |
| InChIKey | BXJGUBZTZWCMEX-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(O)C(C)=C1C |
| CAS DataBase Reference | 608-43-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3-Dimethylhydroquinone(608-43-5) |
Description and Uses
2,3-Xylohydroquinone is a useful synthetic intermediate. It was used in the synthesis of mycophenolic acid analogs with IMP dehydrogenase-inhibiting activities. It is a metabolite of butylamino(dimethylphenoxy)propanol, a new adrenergic β-blocking agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 8-9-23 |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
