A3548012
4,6-Dichloro-<i>o</i>-cresol , >98.0%(GC) , 1570-65-6
CAS NO.:1570-65-6
Empirical Formula: C7H6Cl2O
Molecular Weight: 177.03
MDL number: MFCD00019988
EINECS: 216-382-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB69.60 | In Stock |
|
| 1G | RMB111.20 | In Stock |
|
| 5G | RMB469.60 | In Stock |
|
| 25g | RMB1812.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53°C |
| Boiling point: | 225 °C |
| Density | 1.2970 (rough estimate) |
| refractive index | 1.5625 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.41±0.23(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C7H6Cl2O/c1-4-2-5(8)3-6(9)7(4)10/h2-3,10H,1H3 |
| InChIKey | WJQZZLQMLJPKQH-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C)C=C(Cl)C=C1Cl |
| CAS DataBase Reference | 1570-65-6(CAS DataBase Reference) |
| EPA Substance Registry System | 4,6-Dichloro-o-cresol (1570-65-6) |
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H401-H318-H335 |
| Precautionary statements | P264-P270-P273-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| HS Code | 2908190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







