A7856012
3,5,6-Trichlorosalicylic Acid , 97% , 40932-60-3
Synonym(s):
3,5,6-Trichlorosalicylic acid
CAS NO.:40932-60-3
Empirical Formula: C7H3Cl3O3
Molecular Weight: 241.46
MDL number: MFCD00075245
EINECS: 255-144-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB335.20 | In Stock |
|
| 500G | RMB829.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-211 °C(lit.) |
| Boiling point: | 335.0±42.0 °C(Predicted) |
| Density | 1.772±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 1.50±0.25(Predicted) |
| color | White to Off-White |
| Water Solubility | It has limited solubility in water. |
| BRN | 2940592 |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | InChI=1S/C7H3Cl3O3/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1,11H,(H,12,13) |
| InChIKey | IIHCUZVBIMTHEB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(O)C(Cl)=CC(Cl)=C1Cl |
| CAS DataBase Reference | 40932-60-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2,3,5-trichloro-6-hydroxy- (40932-60-3) |
Description and Uses
3,5,6-Trichlorosalicylic acid is a chlorinated salicylic acid intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P280-P280-P304+P340+P312-P337+P313 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2918999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




