A3558512
Divinyl Adipate (stabilized with MEHQ) , >99.0%(GC) , 4074-90-2
CAS NO.：4074-90-2
Empirical Formula: C10H14O4
Molecular Weight: 198.22
MDL number: MFCD00059202
EINECS: 223-792-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB71.20 | In Stock |
|
| 25G | RMB287.20 | In Stock |
|
| 100G | RMB798.40 | In Stock |
|
| 500G | RMB3654.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28 °C |
| Boiling point: | 261℃ |
| Density | 1,05 g/cm3 |
| refractive index | 1.4549 |
| Flash point: | 28 °C |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| InChI | InChI=1S/C10H14O4/c1-3-13-9(11)7-5-6-8-10(12)14-4-2/h3-4H,1-2,5-8H2 |
| InChIKey | JZQAAQZDDMEFGZ-UHFFFAOYSA-N |
| SMILES | C(OC=C)(=O)CCCCC(OC=C)=O |
| CAS DataBase Reference | 4074-90-2 |
| EPA Substance Registry System | Hexanedioic acid, diethenyl ester (4074-90-2) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| Safety Statements | 23-24/25 |
| RTECS | AV1800000 |
| HS Code | 29171200 |
