A3560012
Diallyl Terephthalate , >98.0%(GC) , 1026-92-2
CAS NO.：1026-92-2
Empirical Formula: C14H14O4
Molecular Weight: 246.26
MDL number: MFCD00080462
EINECS: 213-835-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB144.80 | In Stock |
|
| 100G | RMB187.20 | In Stock |
|
| 500G | RMB619.20 | In Stock |
|
| 2.5kg | RMB2361.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 176-178°C 8mm |
| Density | 1,121 g/cm3 |
| refractive index | 1.5260 to 1.5280 |
| Flash point: | 171°C |
| storage temp. | 2-8°C(protect from light) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C14H14O4/c1-3-9-17-13(15)11-5-7-12(8-6-11)14(16)18-10-4-2/h3-8H,1-2,9-10H2 |
| InChIKey | ZDNFTNPFYCKVTB-UHFFFAOYSA-N |
| SMILES | C1(C(OCC=C)=O)=CC=C(C(OCC=C)=O)C=C1 |
| EPA Substance Registry System | Diallyl terephthalate (1026-92-2) |
Description and Uses
Diallyl Terephthalate is used as a plasticizer. Also used in the preparation of organotin polymers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 |
| RIDADR | 2810 |
| HS Code | 2933.99.8290 |
| HazardClass | 6.1 |
| PackingGroup | III |
