A3562512
(-)-1,4-Di-<i>O</i>-tosyl-2,3-<i>O</i>-isopropylidene-<small>L</small>-threitol , >98.0%(HPLC) , 37002-45-2
Synonym(s):
(−)-2,3-O-Isopropylidene-L -threitol 1,4-ditosylate;(−)-2,3-O-Isopropylidene-1,4-di-O-tosyl-L -threitol;(4S,5S)-4,5-Bis(tosyloxymethyl)-2,2-dimethyl-1,3-dioxolane
CAS NO.：37002-45-2
Empirical Formula: C21H26O8S2
Molecular Weight: 470.56
MDL number: MFCD00003212
EINECS: 253-306-3
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB49.60 | In Stock |
|
| 1G | RMB195.20 | In Stock |
|
| 5G | RMB818.40 | In Stock |
|
| 25g | RMB3839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C(lit.) |
| Boiling point: | 542.03°C (rough estimate) |
| Density | 1.3082 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DCM, Ethyl Acetate |
| form | Powder |
| color | white |
| optical activity | [α]23/D 12.3°, c = 8.8 in chloroform |
| BRN | 99610 |
| Stability: | store cold |
| InChI | InChI=1/C21H26O8S2/c1-15-5-9-17(10-6-15)30(22,23)26-13-19-20(29-21(3,4)28-19)14-27-31(24,25)18-11-7-16(2)8-12-18/h5-12,19-20H,13-14H2,1-4H3/t19-,20-/s3 |
| InChIKey | KPFDKWNWYAXRNJ-XEBFJNFFNA-N |
| SMILES | [C@@H]1(COS(=O)(=O)C2C=CC(C)=CC=2)OC(C)(C)O[C@H]1COS(=O)(=O)C1C=CC(C)=CC=1 |&1:0,18,r| |
| CAS DataBase Reference | 37002-45-2(CAS DataBase Reference) |
Description and Uses
1,4-Di-O-tosyl-2,3-O-isopropylidene-L-threitol has been used in coordination chemistry of (R,R)-DIPPOP.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2932.99.7000 |
