A3565812
3,7-Diamino-2,8-dimethyldibenzothiophene Sulfone (contains 2,6-Dimethyl isomer) , >70.0%(HPLC) , 55011-44-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB79.20 | In Stock |
|
| 5G | RMB343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >350 °C(lit.) |
| storage temp. | -20°C |
| form | powder to crystal |
| color | White to Yellow to Green |
| biological source | rabbit |
| InChI | InChI=1S/C14H14N2O2S/c1-7-3-9-10-4-8(2)12(16)6-14(10)19(17,18)13(9)5-11(7)15/h3-6H,15-16H2,1-2H3 |
| InChIKey | OJSPYCPPVCMEBS-UHFFFAOYSA-N |
| SMILES | C12=CC(N)=C(C)C=C1C1=CC(C)=C(N)C=C1S2(=O)=O |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H302-H315 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | T,N |
| Risk Statements | 45-22-51/53 |
| Safety Statements | 53-45-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | WGK 1 |
| HS Code | 2934.99.9001 |
| Storage Class | 10 - Combustible liquids |






