A3566312
4,4-Dioxo-1,4-oxathiane , >98.0%(GC) , 107-61-9
CAS NO.：107-61-9
Empirical Formula: C4H8O3S
Molecular Weight: 136.17
MDL number: MFCD00011683
EINECS: 203-507-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.00 | In Stock |
|
| 5G | RMB172.80 | In Stock |
|
| 25G | RMB443.20 | In Stock |
|
| 100g | RMB1503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-133 °C |
| Boiling point: | 220.45°C (rough estimate) |
| Density | 1.283 (estimate) |
| refractive index | 1.4640 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| color | White to Almost white |
| BRN | 110609 |
| InChI | InChI=1S/C4H8O3S/c5-8(6)3-1-7-2-4-8/h1-4H2 |
| InChIKey | WWRUZECKUVNAPB-UHFFFAOYSA-N |
| SMILES | O1CCS(=O)(=O)CC1 |
| CAS DataBase Reference | 107-61-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Oxathiane, 4,4-dioxide (107-61-9) |
Description and Uses
1,4-Thioxane-1,1-dioxide is a heterocyclic compound with sulfur and oxygen.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| RTECS | RP4375000 |
| TSCA | Yes |
| HS Code | 2934999090 |
| Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),National Technical Information Service. Vol. AD277-689, |
