A3590712
Disodium Phenyl Phosphate Hydrate , >98.0%(T) , 3279-54-7
CAS NO.:3279-54-7
Empirical Formula: C6H5Na2O4P
Molecular Weight: 218.05
MDL number: MFCD00002133
EINECS: 221-917-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5G | RMB111.20 | In Stock |
|
| 25G | RMB351.20 | In Stock |
|
| 100G | RMB1039.20 | In Stock |
|
| 500G | RMB4103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear |
| form | Crystalline |
| color | Pale yellow |
| PH | pH (50g/l, 25℃) : 6.5~9.5 |
| Water Solubility | Soluble in water (0.1 g/mL). |
| Sensitive | Hygroscopic |
| Merck | 14,3357 |
| BRN | 4167154 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H7O4P.Na.H/c7-11(8,9)10-6-4-2-1-3-5-6;;/h1-5H,(H2,7,8,9);; |
| InChIKey | FILAJVPXXCLSKZ-UHFFFAOYSA-N |
| SMILES | O(C1C=CC=CC=1)P(O)(O)=O.[NaH] |
| CAS DataBase Reference | 3279-54-7(CAS DataBase Reference) |
| EPA Substance Registry System | Disodium phenyl phosphate (3279-54-7) |
Description and Uses
Reagent in the testing of milk for proper pasteurization and for the presence of unpasteurized milk.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H341 |
| Precautionary statements | P501-P261-P270-P202-P201-P271-P264-P280-P308+P313-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312-P405 |
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 22-24/25-45-36/37/39-26-16 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2920.90.2000 |






