PRODUCT Properties
| Boiling point: | 110-112°C 1mm |
| Density | 1,12 g/cm3 |
| refractive index | 1.4940 |
| Flash point: | 267°C |
| storage temp. | Store at room temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | <0.2g/L(25 ºC) |
| BRN | 2449931 |
| InChI | InChI=1S/C10H15O3P/c1-3-12-14(11,13-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | VZEGPPPCKHRYGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(P(=O)(OCC)OCC)C=C1 |
| CAS DataBase Reference | 1754-49-0(CAS DataBase Reference) |
Description and Uses
Diethyl phenylphosphonate is a liquid that can be used as an organophosphine ligand in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| Risk Statements | 22 |
| Safety Statements | 23-36/37-60-36 |
| RIDADR | 2810 |
| RTECS | TA0377000 |
| PackingGroup | III |
| HS Code | 29319090 |
| Toxicity | mouse,LD50,intraperitoneal,790mg/kg (790mg/kg),Farmakologiya i Toksikologiya Vol. 10, Pg. 121, 1975. |
