A3593412
2-(3,5-Dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane , ≥98.0% , 68716-51-8
CAS NO.:68716-51-8
Empirical Formula: C12H15BCl2O2
Molecular Weight: 272.96
MDL number: MFCD05863906
| Pack Size | Price | Stock | Quantity |
| 1G | RMB84.80 | In Stock |
|
| 5G | RMB385.60 | In Stock |
|
| 25g | RMB798.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51.0 to 55.0 °C |
| Boiling point: | 351.1±32.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C12H15BCl2O2/c1-11(2)12(3,4)17-13(16-11)8-5-9(14)7-10(15)6-8/h5-7H,1-4H3 |
| InChIKey | HKSNHZBPIBSVGI-UHFFFAOYSA-N |
| SMILES | B2(OC(C(O2)(C)C)(C)C)c1cc(cc(c1)Cl)Cl |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






