A3594912
4,7-Dichloroisatin , >97.0% , 18711-13-2
CAS NO.：18711-13-2
Empirical Formula: C8H3Cl2NO2
Molecular Weight: 216.02
MDL number: MFCD00047214
EINECS: 622-637-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB82.40 | In Stock |
|
| 5G | RMB251.20 | In Stock |
|
| 25g | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250-252 °C(lit.) |
| Density | 1.643±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.38±0.20(Predicted) |
| color | Light yellow to Brown |
| BRN | 168731 |
| InChI | InChI=1S/C8H3Cl2NO2/c9-3-1-2-4(10)6-5(3)7(12)8(13)11-6/h1-2H,(H,11,12,13) |
| InChIKey | NUXYYWOWNFEMNH-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(Cl)=CC=C2Cl)C(=O)C1=O |
| CAS DataBase Reference | 18711-13-2(CAS DataBase Reference) |
Description and Uses
Used as an intermediate in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
